C14H25F2O4P — CID 166519631
3-[2-(difluorophosphoryloxymethyl)-3-(2-methylbut-3-en-2-yloxy)propoxy]-3-methylbut-1-ene (PubChem CID 166519631) has the molecular formula C14H25F2O4P and a molecular weight of 326.32 g/mol. Its IUPAC name is 3-[2-(difluorophosphoryloxymethyl)-3-(2-methylbut-3-en-2-yloxy)propoxy]-3-methylbut-1-ene.
| Compound Name | 3-[2-(difluorophosphoryloxymethyl)-3-(2-methylbut-3-en-2-yloxy)propoxy]-3-methylbut-1-ene |
|---|---|
| PubChem CID | 166519631 |
| Molecular Formula | C14H25F2O4P |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-[2-(difluorophosphoryloxymethyl)-3-(2-methylbut-3-en-2-yloxy)propoxy]-3-methylbut-1-ene |
| SMILES | C=CC(C)(C)OCC(COC(C)(C)C=C)COP(=O)(F)F |
| InChI | InChI=1S/C14H25F2O4P/c1-7-13(3,4)18-9-12(11-20-21(15,16)17)10-19-14(5,6)8-2/h7-8,12H,1-2,9-11H2,3-6H3 |
| InChIKey | DSELYLBXQBBXKF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|