C40H50N6O6 — CID 166520921
9,10-bis[3-[3-(dimethylamino)propylamino]propylcarbamoyl]perylene-3,4-dicarboxylic acid (PubChem CID 166520921) has the molecular formula C40H50N6O6 and a molecular weight of 710.88 g/mol. Its IUPAC name is 9,10-bis[3-[3-(dimethylamino)propylamino]propylcarbamoyl]perylene-3,4-dicarboxylic acid.
| Compound Name | 9,10-bis[3-[3-(dimethylamino)propylamino]propylcarbamoyl]perylene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 166520921 |
| Molecular Formula | C40H50N6O6 |
| Molecular Weight | 710.88 g/mol |
| Exact Mass | 710.38 |
| IUPAC Name | 9,10-bis[3-[3-(dimethylamino)propylamino]propylcarbamoyl]perylene-3,4-dicarboxylic acid |
| SMILES | CN(C)CCCNCCCNC(=O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)ccc(c5ccc(C(=O)NCCCNCCCN(C)C)c1c25)c43 |
| InChI | InChI=1S/C40H50N6O6/c1-45(2)23-7-19-41-17-5-21-43-37(47)29-13-9-25-27-11-15-31(39(49)50)36-32(40(51)52)16-12-28(34(27)36)26-10-14-30(35(29)33(25)26)38(48)44-22-6-18-42-20-8-24-46(3)4/h9-16,41-42H,5-8,17-24H2,1-4H3,(H,43,47)(H,44,48)(H,49,50)(H,51,52) |
| InChIKey | RZKMFGDCCOOJNW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 163.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.88 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|