C27H37N3O7Si — CID 166521082
[(3R,3aR,6S,6aS)-3-[3-[[2-[tert-butyl(diphenyl)silyl]oxyacetyl]amino]propylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate (PubChem CID 166521082) has the molecular formula C27H37N3O7Si and a molecular weight of 543.69 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-3-[3-[[2-[tert-butyl(diphenyl)silyl]oxyacetyl]amino]propylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate.
| Compound Name | [(3R,3aR,6S,6aS)-3-[3-[[2-[tert-butyl(diphenyl)silyl]oxyacetyl]amino]propylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
|---|---|
| PubChem CID | 166521082 |
| Molecular Formula | C27H37N3O7Si |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | [(3R,3aR,6S,6aS)-3-[3-[[2-[tert-butyl(diphenyl)silyl]oxyacetyl]amino]propylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
| SMILES | CC(C)(C)[Si](OCC(=O)NCCCN[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O[N+](=O)[O-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H37N3O7Si/c1-27(2,3)38(20-11-6-4-7-12-20,21-13-8-5-9-14-21)36-19-24(31)29-16-10-15-28-22-17-34-26-23(37-30(32)33)18-35-25(22)26/h4-9,11-14,22-23,25-26,28H,10,15-19H2,1-3H3,(H,29,31)/t22-,23+,25-,26-/m1/s1 |
| InChIKey | IWQURXFCKFXLPT-PZXVYJQKSA-N |
| XLogP | 1.40 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|