C28H38O5SSi — CID 166521240
(3aR,4R,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-pentylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one (PubChem CID 166521240) has the molecular formula C28H38O5SSi and a molecular weight of 514.76 g/mol. Its IUPAC name is (3aR,4R,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-pentylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one.
| Compound Name | (3aR,4R,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-pentylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one |
|---|---|
| PubChem CID | 166521240 |
| Molecular Formula | C28H38O5SSi |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | (3aR,4R,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-pentylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one |
| SMILES | CCCCCS[C@@H]1C[C@H]2OC(=O)O[C@H]2[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C28H38O5SSi/c1-5-6-13-18-34-25-19-23-26(33-27(29)32-23)24(31-25)20-30-35(28(2,3)4,21-14-9-7-10-15-21)22-16-11-8-12-17-22/h7-12,14-17,23-26H,5-6,13,18-20H2,1-4H3/t23-,24-,25-,26-/m1/s1 |
| InChIKey | VHVAZRLEAZPALF-VEYUFSJPSA-N |
| XLogP | 5.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|