C30H34O5SSi — CID 166521241
(3aR,4R,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-methylphenyl)sulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one (PubChem CID 166521241) has the molecular formula C30H34O5SSi and a molecular weight of 534.75 g/mol. Its IUPAC name is (3aR,4R,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-methylphenyl)sulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one.
| Compound Name | (3aR,4R,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-methylphenyl)sulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one |
|---|---|
| PubChem CID | 166521241 |
| Molecular Formula | C30H34O5SSi |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | (3aR,4R,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-methylphenyl)sulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one |
| SMILES | Cc1ccc(S[C@@H]2C[C@H]3OC(=O)O[C@H]3[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C30H34O5SSi/c1-21-15-17-22(18-16-21)36-27-19-25-28(35-29(31)34-25)26(33-27)20-32-37(30(2,3)4,23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,25-28H,19-20H2,1-4H3/t25-,26-,27-,28-/m1/s1 |
| InChIKey | ZOHGHQTWOWCANU-BIYDSLDMSA-N |
| XLogP | 5.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|