C31H35N9O2 — CID 166521838
3-tert-butyl-N-[(1R)-1-[2-methyl-4-[8-(4-piperazin-1-ylphenyl)-7H-purin-6-yl]phenyl]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 166521838) has the molecular formula C31H35N9O2 and a molecular weight of 565.68 g/mol. Its IUPAC name is 3-tert-butyl-N-[(1R)-1-[2-methyl-4-[8-(4-piperazin-1-ylphenyl)-7H-purin-6-yl]phenyl]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-tert-butyl-N-[(1R)-1-[2-methyl-4-[8-(4-piperazin-1-ylphenyl)-7H-purin-6-yl]phenyl]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 166521838 |
| Molecular Formula | C31H35N9O2 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 3-tert-butyl-N-[(1R)-1-[2-methyl-4-[8-(4-piperazin-1-ylphenyl)-7H-purin-6-yl]phenyl]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc(-c2ncnc3nc(-c4ccc(N5CCNCC5)cc4)[nH]c23)ccc1[C@@H](C)NC(=O)c1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C31H35N9O2/c1-18-16-21(8-11-23(18)19(2)35-28(41)29-38-30(39-42-29)31(3,4)5)24-25-27(34-17-33-24)37-26(36-25)20-6-9-22(10-7-20)40-14-12-32-13-15-40/h6-11,16-17,19,32H,12-15H2,1-5H3,(H,35,41)(H,33,34,36,37)/t19-/m1/s1 |
| InChIKey | ZBWQMGGCZOOPTB-LJQANCHMSA-N |
| XLogP | 4.58 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|