C34H28ClN3O6S2 — CID 166522346
(2S)-2-[[2-[5-[[4-(4-chlorophenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide (PubChem CID 166522346) has the molecular formula C34H28ClN3O6S2 and a molecular weight of 674.20 g/mol. Its IUPAC name is (2S)-2-[[2-[5-[[4-(4-chlorophenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[5-[[4-(4-chlorophenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 166522346 |
| Molecular Formula | C34H28ClN3O6S2 |
| Molecular Weight | 674.20 g/mol |
| Exact Mass | 673.11 |
| IUPAC Name | (2S)-2-[[2-[5-[[4-(4-chlorophenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)[C@H](Cc2ccccc2)NC(=O)CN2C(=O)SC(=Cc3ccc(-c4ccc(Cl)cc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C34H28ClN3O6S2/c1-22-7-17-28(18-8-22)46(43,44)37-32(40)29(19-23-5-3-2-4-6-23)36-31(39)21-38-33(41)30(45-34(38)42)20-24-9-11-25(12-10-24)26-13-15-27(35)16-14-26/h2-18,20,29H,19,21H2,1H3,(H,36,39)(H,37,40)/t29-/m0/s1 |
| InChIKey | RJKVIRQSDAJIKB-LJAQVGFWSA-N |
| XLogP | 5.58 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.20 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|