C33H24BrClN4O8S2 — CID 166522360
(2S)-3-(4-bromophenyl)-2-[[2-[5-[[4-(4-chlorophenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-nitrophenyl)sulfonylpropanamide (PubChem CID 166522360) has the molecular formula C33H24BrClN4O8S2 and a molecular weight of 784.07 g/mol. Its IUPAC name is (2S)-3-(4-bromophenyl)-2-[[2-[5-[[4-(4-chlorophenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-nitrophenyl)sulfonylpropanamide.
| Compound Name | (2S)-3-(4-bromophenyl)-2-[[2-[5-[[4-(4-chlorophenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-nitrophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 166522360 |
| Molecular Formula | C33H24BrClN4O8S2 |
| Molecular Weight | 784.07 g/mol |
| Exact Mass | 781.99 |
| IUPAC Name | (2S)-3-(4-bromophenyl)-2-[[2-[5-[[4-(4-chlorophenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-nitrophenyl)sulfonylpropanamide |
| SMILES | O=C(CN1C(=O)SC(=Cc2ccc(-c3ccc(Cl)cc3)cc2)C1=O)N[C@@H](Cc1ccc(Br)cc1)C(=O)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H24BrClN4O8S2/c34-24-9-3-20(4-10-24)17-28(31(41)37-49(46,47)27-15-13-26(14-16-27)39(44)45)36-30(40)19-38-32(42)29(48-33(38)43)18-21-1-5-22(6-2-21)23-7-11-25(35)12-8-23/h1-16,18,28H,17,19H2,(H,36,40)(H,37,41)/t28-/m0/s1 |
| InChIKey | BPJZHCVZMDRSLO-NDEPHWFRSA-N |
| XLogP | 5.95 |
| TPSA | 172.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.07 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|