C35H31N3O6S2 — CID 166522361
(2S)-2-[[2-[5-[[4-(4-methylphenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide (PubChem CID 166522361) has the molecular formula C35H31N3O6S2 and a molecular weight of 653.78 g/mol. Its IUPAC name is (2S)-2-[[2-[5-[[4-(4-methylphenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[5-[[4-(4-methylphenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 166522361 |
| Molecular Formula | C35H31N3O6S2 |
| Molecular Weight | 653.78 g/mol |
| Exact Mass | 653.17 |
| IUPAC Name | (2S)-2-[[2-[5-[[4-(4-methylphenyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide |
| SMILES | Cc1ccc(-c2ccc(C=C3SC(=O)N(CC(=O)N[C@@H](Cc4ccccc4)C(=O)NS(=O)(=O)c4ccc(C)cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C35H31N3O6S2/c1-23-8-14-27(15-9-23)28-16-12-26(13-17-28)21-31-34(41)38(35(42)45-31)22-32(39)36-30(20-25-6-4-3-5-7-25)33(40)37-46(43,44)29-18-10-24(2)11-19-29/h3-19,21,30H,20,22H2,1-2H3,(H,36,39)(H,37,40)/t30-/m0/s1 |
| InChIKey | IRCIMDRCGDCQBQ-PMERELPUSA-N |
| XLogP | 5.24 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.78 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|