C19H18Cl5F — CID 166522420
1,2-dimethyl-4-[1,1,1,3,3-pentachloro-2-(3,4-dimethylphenyl)-3-fluoropropan-2-yl]benzene (PubChem CID 166522420) has the molecular formula C19H18Cl5F and a molecular weight of 442.62 g/mol. Its IUPAC name is 1,2-dimethyl-4-[1,1,1,3,3-pentachloro-2-(3,4-dimethylphenyl)-3-fluoropropan-2-yl]benzene.
| Compound Name | 1,2-dimethyl-4-[1,1,1,3,3-pentachloro-2-(3,4-dimethylphenyl)-3-fluoropropan-2-yl]benzene |
|---|---|
| PubChem CID | 166522420 |
| Molecular Formula | C19H18Cl5F |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | 1,2-dimethyl-4-[1,1,1,3,3-pentachloro-2-(3,4-dimethylphenyl)-3-fluoropropan-2-yl]benzene |
| SMILES | Cc1ccc(C(c2ccc(C)c(C)c2)(C(F)(Cl)Cl)C(Cl)(Cl)Cl)cc1C |
| InChI | InChI=1S/C19H18Cl5F/c1-11-5-7-15(9-13(11)3)17(18(20,21)22,19(23,24)25)16-8-6-12(2)14(4)10-16/h5-10H,1-4H3 |
| InChIKey | VDTYXXJZXHFWKX-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|