About 6-ethenylcyclohexa-1,3-diene-1,2-dithiol
6-ethenylcyclohexa-1,3-diene-1,2-dithiol (PubChem CID 166522442) has the molecular formula C8H10S2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 6-ethenylcyclohexa-1,3-diene-1,2-dithiol.
Molecular Properties
| Compound Name | 6-ethenylcyclohexa-1,3-diene-1,2-dithiol |
| PubChem CID | 166522442 |
| Molecular Formula | C8H10S2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 6-ethenylcyclohexa-1,3-diene-1,2-dithiol |
| SMILES | C=CC1CC=CC(S)=C1S |
| InChI | InChI=1S/C8H10S2/c1-2-6-4-3-5-7(9)8(6)10/h2-3,5-6,9-10H,1,4H2 |
| InChIKey | ZXKHFCAONKEWPK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-ethenylcyclohexa-1,3-diene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenylcyclohexa-1,3-diene-1,2-dithiol?
The IUPAC name of 6-ethenylcyclohexa-1,3-diene-1,2-dithiol (CID 166522442) is 6-ethenylcyclohexa-1,3-diene-1,2-dithiol.
What is the SMILES notation for 6-ethenylcyclohexa-1,3-diene-1,2-dithiol?
The canonical SMILES for 6-ethenylcyclohexa-1,3-diene-1,2-dithiol is C=CC1CC=CC(S)=C1S.
What is the InChIKey of 6-ethenylcyclohexa-1,3-diene-1,2-dithiol?
The InChIKey is ZXKHFCAONKEWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S2/c1-2-6-4-3-5-7(9)8(6)10/h2-3,5-6,9-10H,1,4H2.
What are the key properties of 6-ethenylcyclohexa-1,3-diene-1,2-dithiol?
6-ethenylcyclohexa-1,3-diene-1,2-dithiol has a molecular weight of 170.30 g/mol, XLogP of 2.82, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenylcyclohexa-1,3-diene-1,2-dithiol is sourced from PubChem (CID 166522442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).