C12H13ClF3N3O2 — CID 166522986
3-[(2R)-1-[6-chloro-5-(trifluoromethyl)pyridazin-3-yl]pyrrolidin-2-yl]propanoic acid (PubChem CID 166522986) has the molecular formula C12H13ClF3N3O2 and a molecular weight of 323.70 g/mol. Its IUPAC name is 3-[(2R)-1-[6-chloro-5-(trifluoromethyl)pyridazin-3-yl]pyrrolidin-2-yl]propanoic acid.
| Compound Name | 3-[(2R)-1-[6-chloro-5-(trifluoromethyl)pyridazin-3-yl]pyrrolidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 166522986 |
| Molecular Formula | C12H13ClF3N3O2 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-[(2R)-1-[6-chloro-5-(trifluoromethyl)pyridazin-3-yl]pyrrolidin-2-yl]propanoic acid |
| SMILES | O=C(O)CC[C@H]1CCCN1c1cc(C(F)(F)F)c(Cl)nn1 |
| InChI | InChI=1S/C12H13ClF3N3O2/c13-11-8(12(14,15)16)6-9(17-18-11)19-5-1-2-7(19)3-4-10(20)21/h6-7H,1-5H2,(H,20,21)/t7-/m1/s1 |
| InChIKey | RKQIBTHFFMWJGC-SSDOTTSWSA-N |
| XLogP | 2.98 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |