C20H35ClN4O — CID 166524559
(2R)-8-chloro-2-methyl-3,9,16,22-tetrazatetracyclo[14.5.2.05,10.019,23]tricosan-4-one (PubChem CID 166524559) has the molecular formula C20H35ClN4O and a molecular weight of 382.98 g/mol. Its IUPAC name is (2R)-8-chloro-2-methyl-3,9,16,22-tetrazatetracyclo[14.5.2.05,10.019,23]tricosan-4-one.
| Compound Name | (2R)-8-chloro-2-methyl-3,9,16,22-tetrazatetracyclo[14.5.2.05,10.019,23]tricosan-4-one |
|---|---|
| PubChem CID | 166524559 |
| Molecular Formula | C20H35ClN4O |
| Molecular Weight | 382.98 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (2R)-8-chloro-2-methyl-3,9,16,22-tetrazatetracyclo[14.5.2.05,10.019,23]tricosan-4-one |
| SMILES | C[C@H]1NC(=O)C2CCC(Cl)NC2CCCCCN2CCC3CCC1NC32 |
| InChI | InChI=1S/C20H35ClN4O/c1-13-16-8-6-14-10-12-25(19(14)24-16)11-4-2-3-5-17-15(20(26)22-13)7-9-18(21)23-17/h13-19,23-24H,2-12H2,1H3,(H,22,26)/t13-,14?,15?,16?,17?,18?,19?/m1/s1 |
| InChIKey | VPTPQJNTEDCNRI-MGLLRRBKSA-N |
| XLogP | 2.40 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.98 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|