C34H43NO5Si — CID 166524573
(4S)-4-benzyl-3-[(3R)-8-[tert-butyl(diphenyl)silyl]oxy-3-hydroxyoctanoyl]-1,3-oxazolidin-2-one (PubChem CID 166524573) has the molecular formula C34H43NO5Si and a molecular weight of 573.81 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(3R)-8-[tert-butyl(diphenyl)silyl]oxy-3-hydroxyoctanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(3R)-8-[tert-butyl(diphenyl)silyl]oxy-3-hydroxyoctanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 166524573 |
| Molecular Formula | C34H43NO5Si |
| Molecular Weight | 573.81 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | (4S)-4-benzyl-3-[(3R)-8-[tert-butyl(diphenyl)silyl]oxy-3-hydroxyoctanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](OCCCCC[C@@H](O)CC(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H43NO5Si/c1-34(2,3)41(30-19-11-5-12-20-30,31-21-13-6-14-22-31)40-23-15-7-10-18-29(36)25-32(37)35-28(26-39-33(35)38)24-27-16-8-4-9-17-27/h4-6,8-9,11-14,16-17,19-22,28-29,36H,7,10,15,18,23-26H2,1-3H3/t28-,29+/m0/s1 |
| InChIKey | CREDNAODQNKXCU-URLMMPGGSA-N |
| XLogP | 5.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.81 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|