C9H12F2O2 — CID 166524736
methyl 2-[(1R,3S)-3-ethenyl-2,2-difluoro-1-methylcyclopropyl]acetate (PubChem CID 166524736) has the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. Its IUPAC name is methyl 2-[(1R,3S)-3-ethenyl-2,2-difluoro-1-methylcyclopropyl]acetate.
| Compound Name | methyl 2-[(1R,3S)-3-ethenyl-2,2-difluoro-1-methylcyclopropyl]acetate |
|---|---|
| PubChem CID | 166524736 |
| Molecular Formula | C9H12F2O2 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | methyl 2-[(1R,3S)-3-ethenyl-2,2-difluoro-1-methylcyclopropyl]acetate |
| SMILES | C=C[C@@H]1C(F)(F)[C@]1(C)CC(=O)OC |
| InChI | InChI=1S/C9H12F2O2/c1-4-6-8(2,9(6,10)11)5-7(12)13-3/h4,6H,1,5H2,2-3H3/t6-,8+/m0/s1 |
| InChIKey | KPKLFPVPHCSKJD-POYBYMJQSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|