C25H27F5N4O2 — CID 166525314
2-[3-[5-[(R)-(1,3-dimethylazetidin-3-yl)-hydroxy-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-pyridinyl]-1H-pyrazol-5-yl]propan-2-ol (PubChem CID 166525314) has the molecular formula C25H27F5N4O2 and a molecular weight of 510.51 g/mol. Its IUPAC name is 2-[3-[5-[(R)-(1,3-dimethylazetidin-3-yl)-hydroxy-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-pyridinyl]-1H-pyrazol-5-yl]propan-2-ol.
| Compound Name | 2-[3-[5-[(R)-(1,3-dimethylazetidin-3-yl)-hydroxy-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-pyridinyl]-1H-pyrazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 166525314 |
| Molecular Formula | C25H27F5N4O2 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 2-[3-[5-[(R)-(1,3-dimethylazetidin-3-yl)-hydroxy-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-pyridinyl]-1H-pyrazol-5-yl]propan-2-ol |
| SMILES | CN1CC(C)([C@](O)(c2ccc(C(F)(F)C(F)(F)F)cc2)c2cncc(-c3cc(C(C)(C)O)[nH]n3)c2)C1 |
| InChI | InChI=1S/C25H27F5N4O2/c1-21(2,35)20-10-19(32-33-20)15-9-18(12-31-11-15)23(36,22(3)13-34(4)14-22)16-5-7-17(8-6-16)24(26,27)25(28,29)30/h5-12,35-36H,13-14H2,1-4H3,(H,32,33)/t23-/m0/s1 |
| InChIKey | JPISPTDRTBBWOW-QHCPKHFHSA-N |
| XLogP | 4.54 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|