C25H28FN5O6 — CID 166525711
[(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone (PubChem CID 166525711) has the molecular formula C25H28FN5O6 and a molecular weight of 513.53 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166525711 |
| Molecular Formula | C25H28FN5O6 |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-[4-(4-hydroxyphenyl)piperazin-1-yl]methanone |
| SMILES | O=C([C@@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3cccc(F)c3)nn2)[C@H]1O)N1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C25H28FN5O6/c26-16-3-1-2-15(12-16)19-13-31(28-27-19)21-22(34)20(14-32)37-24(23(21)35)25(36)30-10-8-29(9-11-30)17-4-6-18(33)7-5-17/h1-7,12-13,20-24,32-35H,8-11,14H2/t20-,21+,22+,23-,24-/m1/s1 |
| InChIKey | MIUGLDXCOYRIFB-OYTPZHDJSA-N |
| XLogP | 0.16 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |