C12H12N2O — CID 166525760
4-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,2-oxazole (PubChem CID 166525760) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,2-oxazole.
| Compound Name | 4-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 166525760 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 4-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,2-oxazole |
| SMILES | c1cc2c(cc1-c1cnoc1)CCNC2 |
| InChI | InChI=1S/C12H12N2O/c1-2-11-6-13-4-3-10(11)5-9(1)12-7-14-15-8-12/h1-2,5,7-8,13H,3-4,6H2 |
| InChIKey | MZTWWAAEGDEAFH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |