About 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone
1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone (PubChem CID 166525771) has the molecular formula C25H25NO4S
and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone |
| PubChem CID | 166525771 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(COc2ccc(CN3Cc4ccccc4C3)cc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H25NO4S/c1-18(27)21-10-7-19(8-11-21)17-30-24-12-9-20(13-25(24)31(2,28)29)14-26-15-22-5-3-4-6-23(22)16-26/h3-13H,14-17H2,1-2H3 |
| InChIKey | CNXPECMTQWMUQX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone?
The IUPAC name of 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone (CID 166525771) is 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone.
What is the SMILES notation for 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone?
The canonical SMILES for 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone is CC(=O)c1ccc(COc2ccc(CN3Cc4ccccc4C3)cc2S(C)(=O)=O)cc1.
What is the InChIKey of 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone?
The InChIKey is CNXPECMTQWMUQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO4S/c1-18(27)21-10-7-19(8-11-21)17-30-24-12-9-20(13-25(24)31(2,28)29)14-26-15-22-5-3-4-6-23(22)16-26/h3-13H,14-17H2,1-2H3.
What are the key properties of 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone?
1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone has a molecular weight of 435.55 g/mol, XLogP of 4.39, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]phenyl]ethanone is sourced from PubChem (CID 166525771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).