C10H9N3S — CID 166525819
2-(2,3-dihydro-1H-isoindol-5-yl)-1,3,4-thiadiazole (PubChem CID 166525819) has the molecular formula C10H9N3S and a molecular weight of 203.27 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-isoindol-5-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(2,3-dihydro-1H-isoindol-5-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 166525819 |
| Molecular Formula | C10H9N3S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 2-(2,3-dihydro-1H-isoindol-5-yl)-1,3,4-thiadiazole |
| SMILES | c1nnc(-c2ccc3c(c2)CNC3)s1 |
| InChI | InChI=1S/C10H9N3S/c1-2-8-4-11-5-9(8)3-7(1)10-13-12-6-14-10/h1-3,6,11H,4-5H2 |
| InChIKey | PCHFJFXZQCQHFC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |