C22H16F4N4O3 — CID 166526259
1-(difluoromethyl)-N-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-N-methylindazole-5-carboxamide (PubChem CID 166526259) has the molecular formula C22H16F4N4O3 and a molecular weight of 460.39 g/mol. Its IUPAC name is 1-(difluoromethyl)-N-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-N-methylindazole-5-carboxamide.
| Compound Name | 1-(difluoromethyl)-N-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-N-methylindazole-5-carboxamide |
|---|---|
| PubChem CID | 166526259 |
| Molecular Formula | C22H16F4N4O3 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 1-(difluoromethyl)-N-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-N-methylindazole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(cnn2C(F)F)c1)[C@H]1COCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C22H16F4N4O3/c1-29(21(32)10-2-3-17-11(4-10)7-27-30(17)22(25)26)18-9-33-8-16-19(18)12-5-14(23)15(24)6-13(12)20(31)28-16/h2-7,18,22H,8-9H2,1H3,(H,28,31)/t18-/m0/s1 |
| InChIKey | LZGHYHCBWWIDIQ-SFHVURJKSA-N |
| XLogP | 3.89 |
| TPSA | 80.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |