C21H32N3O4P — CID 166527052
N-[4-(2-diethoxyphosphorylethyl)cyclohexyl]-8-methoxyquinazolin-4-amine (PubChem CID 166527052) has the molecular formula C21H32N3O4P and a molecular weight of 421.48 g/mol. Its IUPAC name is N-[4-(2-diethoxyphosphorylethyl)cyclohexyl]-8-methoxyquinazolin-4-amine.
| Compound Name | N-[4-(2-diethoxyphosphorylethyl)cyclohexyl]-8-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 166527052 |
| Molecular Formula | C21H32N3O4P |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[4-(2-diethoxyphosphorylethyl)cyclohexyl]-8-methoxyquinazolin-4-amine |
| SMILES | CCOP(=O)(CCC1CCC(Nc2ncnc3c(OC)cccc23)CC1)OCC |
| InChI | InChI=1S/C21H32N3O4P/c1-4-27-29(25,28-5-2)14-13-16-9-11-17(12-10-16)24-21-18-7-6-8-19(26-3)20(18)22-15-23-21/h6-8,15-17H,4-5,9-14H2,1-3H3,(H,22,23,24) |
| InChIKey | SYWOLSUIVBHJDJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|