C27H27N2O4P — CID 166527168
6-[bis(4-methoxyphenyl)phosphorylmethyl]-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one (PubChem CID 166527168) has the molecular formula C27H27N2O4P and a molecular weight of 474.50 g/mol. Its IUPAC name is 6-[bis(4-methoxyphenyl)phosphorylmethyl]-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one.
| Compound Name | 6-[bis(4-methoxyphenyl)phosphorylmethyl]-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 166527168 |
| Molecular Formula | C27H27N2O4P |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 6-[bis(4-methoxyphenyl)phosphorylmethyl]-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one |
| SMILES | COc1ccc(P(=O)(CC2CCCn3c2nc2ccccc2c3=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H27N2O4P/c1-32-20-9-13-22(14-10-20)34(31,23-15-11-21(33-2)12-16-23)18-19-6-5-17-29-26(19)28-25-8-4-3-7-24(25)27(29)30/h3-4,7-16,19H,5-6,17-18H2,1-2H3 |
| InChIKey | ACGMTEVPJGVXDZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|