About N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane
N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane (PubChem CID 166528298) has the molecular formula C10H15F2N3O2
and a molecular weight of 247.24 g/mol. Its IUPAC name is N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane.
Molecular Properties
| Compound Name | N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane |
| PubChem CID | 166528298 |
| Molecular Formula | C10H15F2N3O2 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane |
| SMILES | C.Cn1cc(NC=O)c(OC2CC(F)(F)C2)n1 |
| InChI | InChI=1S/C9H11F2N3O2.CH4/c1-14-4-7(12-5-15)8(13-14)16-6-2-9(10,11)3-6;/h4-6H,2-3H2,1H3,(H,12,15);1H4 |
| InChIKey | GMYMPVBGYXROAR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane?
The IUPAC name of N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane (CID 166528298) is N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane.
What is the SMILES notation for N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane?
The canonical SMILES for N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane is C.Cn1cc(NC=O)c(OC2CC(F)(F)C2)n1.
What is the InChIKey of N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane?
The InChIKey is GMYMPVBGYXROAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2N3O2.CH4/c1-14-4-7(12-5-15)8(13-14)16-6-2-9(10,11)3-6;/h4-6H,2-3H2,1H3,(H,12,15);1H4.
What are the key properties of N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane?
N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane has a molecular weight of 247.24 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,3-difluorocyclobutyl)oxy-1-methylpyrazol-4-yl]formamide;methane is sourced from PubChem (CID 166528298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).