C18H17F7N4O3S — CID 166528396
1-[(3,3-difluorocyclobutyl)methyl]-4-methyl-N-(2-methylsulfonyl-4-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxamide (PubChem CID 166528396) has the molecular formula C18H17F7N4O3S and a molecular weight of 502.41 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclobutyl)methyl]-4-methyl-N-(2-methylsulfonyl-4-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxamide.
| Compound Name | 1-[(3,3-difluorocyclobutyl)methyl]-4-methyl-N-(2-methylsulfonyl-4-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166528396 |
| Molecular Formula | C18H17F7N4O3S |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 1-[(3,3-difluorocyclobutyl)methyl]-4-methyl-N-(2-methylsulfonyl-4-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxamide |
| SMILES | Cc1c(C(F)(F)C(F)(F)F)nn(CC2CC(F)(F)C2)c1C(=O)Nc1ccnc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H17F7N4O3S/c1-9-13(15(30)27-11-3-4-26-12(5-11)33(2,31)32)29(8-10-6-16(19,20)7-10)28-14(9)17(21,22)18(23,24)25/h3-5,10H,6-8H2,1-2H3,(H,26,27,30) |
| InChIKey | HPPNGKRDJRGUGQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|