C18H24F5N5O3S — CID 166528634
1-[(4,4-difluorocyclohexyl)methyl]-N-[(E,1Z)-1-hydrazinylidene-4-methylsulfonylbut-2-en-2-yl]-3-methyl-4-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 166528634) has the molecular formula C18H24F5N5O3S and a molecular weight of 485.48 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]-N-[(E,1Z)-1-hydrazinylidene-4-methylsulfonylbut-2-en-2-yl]-3-methyl-4-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]-N-[(E,1Z)-1-hydrazinylidene-4-methylsulfonylbut-2-en-2-yl]-3-methyl-4-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166528634 |
| Molecular Formula | C18H24F5N5O3S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]-N-[(E,1Z)-1-hydrazinylidene-4-methylsulfonylbut-2-en-2-yl]-3-methyl-4-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cc1nn(CC2CCC(F)(F)CC2)c(C(=O)NC(/C=N\N)=C/CS(C)(=O)=O)c1C(F)(F)F |
| InChI | InChI=1S/C18H24F5N5O3S/c1-11-14(18(21,22)23)15(16(29)26-13(9-25-24)5-8-32(2,30)31)28(27-11)10-12-3-6-17(19,20)7-4-12/h5,9,12H,3-4,6-8,10,24H2,1-2H3,(H,26,29)/b13-5+,25-9- |
| InChIKey | YLSHRUCWJZOXKL-TWILGOGNSA-N |
| XLogP | 2.64 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|