C10H15F3N2OS — CID 166529024
2-methylpropane;N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]formamide (PubChem CID 166529024) has the molecular formula C10H15F3N2OS and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-methylpropane;N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]formamide.
| Compound Name | 2-methylpropane;N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]formamide |
|---|---|
| PubChem CID | 166529024 |
| Molecular Formula | C10H15F3N2OS |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-methylpropane;N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]formamide |
| SMILES | CC(C)C.O=CNCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C6H5F3N2OS.C4H10/c7-6(8,9)4-2-13-5(11-4)1-10-3-12;1-4(2)3/h2-3H,1H2,(H,10,12);4H,1-3H3 |
| InChIKey | RKDZMGJKUDJXIX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|