About CID 166529225
CID 166529225 (PubChem CID 166529225) has the molecular formula C7H7OPPb2
and a molecular weight of 552.51 g/mol.
Molecular Properties
| Compound Name | CID 166529225 |
| PubChem CID | 166529225 |
| Molecular Formula | C7H7OPPb2 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 553.98 |
| IUPAC Name | — |
| SMILES | O=Cc1ccccc1P.[Pb].[Pb] |
| InChI | InChI=1S/C7H7OP.2Pb/c8-5-6-3-1-2-4-7(6)9;;/h1-5H,9H2;; |
| InChIKey | QVRJMHRUDJFTKR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 166529225 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166529225?
The IUPAC name of CID 166529225 (CID 166529225) is not available.
What is the SMILES notation for CID 166529225?
The canonical SMILES for CID 166529225 is O=Cc1ccccc1P.[Pb].[Pb].
What is the InChIKey of CID 166529225?
The InChIKey is QVRJMHRUDJFTKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7OP.2Pb/c8-5-6-3-1-2-4-7(6)9;;/h1-5H,9H2;;.
What are the key properties of CID 166529225?
CID 166529225 has a molecular weight of 552.51 g/mol, XLogP of 0.24, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166529225 is sourced from PubChem (CID 166529225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).