C16H19NO — CID 166529302
[(3Z,7Z)-10-methyl-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl] cyanate (PubChem CID 166529302) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is [(3Z,7Z)-10-methyl-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl] cyanate.
| Compound Name | [(3Z,7Z)-10-methyl-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl] cyanate |
|---|---|
| PubChem CID | 166529302 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | [(3Z,7Z)-10-methyl-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl] cyanate |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C\C(=C)C(C)C)OC#N |
| InChI | InChI=1S/C16H19NO/c1-12(2)13(3)7-8-14(4)15(5)9-10-16(6)18-11-17/h7-10,12H,3-6H2,1-2H3/b8-7-,10-9- |
| InChIKey | RXGZMAWIBZZUDH-QRLRYFCNSA-N |
| XLogP | 4.43 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|