C14H13F6NO2S — CID 166530301
1-[2,4-bis(trifluoromethyl)phenyl]sulfanylpiperidine-3-carboxylic acid (PubChem CID 166530301) has the molecular formula C14H13F6NO2S and a molecular weight of 373.32 g/mol. Its IUPAC name is 1-[2,4-bis(trifluoromethyl)phenyl]sulfanylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2,4-bis(trifluoromethyl)phenyl]sulfanylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166530301 |
| Molecular Formula | C14H13F6NO2S |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 1-[2,4-bis(trifluoromethyl)phenyl]sulfanylpiperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(Sc2ccc(C(F)(F)F)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H13F6NO2S/c15-13(16,17)9-3-4-11(10(6-9)14(18,19)20)24-21-5-1-2-8(7-21)12(22)23/h3-4,6,8H,1-2,5,7H2,(H,22,23) |
| InChIKey | YXBVSCIZMSKHPL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|