C16H20N4O — CID 166530333
ethane;3-[[4-(1H-imidazol-5-yl)phenyl]methyl]pyrimidin-4-one;molecular hydrogen (PubChem CID 166530333) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is ethane;3-[[4-(1H-imidazol-5-yl)phenyl]methyl]pyrimidin-4-one;molecular hydrogen.
| Compound Name | ethane;3-[[4-(1H-imidazol-5-yl)phenyl]methyl]pyrimidin-4-one;molecular hydrogen |
|---|---|
| PubChem CID | 166530333 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | ethane;3-[[4-(1H-imidazol-5-yl)phenyl]methyl]pyrimidin-4-one;molecular hydrogen |
| SMILES | CC.O=c1ccncn1Cc1ccc(-c2cnc[nH]2)cc1.[H][H] |
| InChI | InChI=1S/C14H12N4O.C2H6.H2/c19-14-5-6-15-10-18(14)8-11-1-3-12(4-2-11)13-7-16-9-17-13;1-2;/h1-7,9-10H,8H2,(H,16,17);1-2H3;1H |
| InChIKey | IRYQWCDDFKTCML-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |