About 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone
2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone (PubChem CID 166530611) has the molecular formula C18H20N2O
and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone.
Molecular Properties
| Compound Name | 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone |
| PubChem CID | 166530611 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone |
| SMILES | CNCC(=O)N1C[C@H]2C[C@@]2(c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C18H20N2O/c1-19-10-17(21)20-11-16-9-18(16,12-20)15-7-6-13-4-2-3-5-14(13)8-15/h2-8,16,19H,9-12H2,1H3/t16-,18+/m1/s1 |
| InChIKey | NQMLERHOYSRHHI-AEFFLSMTSA-N |
| XLogP | 2.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone?
The IUPAC name of 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone (CID 166530611) is 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone.
What is the SMILES notation for 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone?
The canonical SMILES for 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone is CNCC(=O)N1C[C@H]2C[C@@]2(c2ccc3ccccc3c2)C1.
What is the InChIKey of 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone?
The InChIKey is NQMLERHOYSRHHI-AEFFLSMTSA-N. The full InChI is InChI=1S/C18H20N2O/c1-19-10-17(21)20-11-16-9-18(16,12-20)15-7-6-13-4-2-3-5-14(13)8-15/h2-8,16,19H,9-12H2,1H3/t16-,18+/m1/s1.
What are the key properties of 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone?
2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone has a molecular weight of 280.37 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-1-[(1R,5S)-1-naphthalen-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]ethanone is sourced from PubChem (CID 166530611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).