C28H26BrO4P — CID 166530663
2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 166530663) has the molecular formula C28H26BrO4P and a molecular weight of 537.39 g/mol. Its IUPAC name is 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 166530663 |
| Molecular Formula | C28H26BrO4P |
| Molecular Weight | 537.39 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C28H26BrO4P/c1-20-24(26(31)28(33-3)27(32-2)25(20)30)19-34(29,21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18H,19H2,1-3H3 |
| InChIKey | SZSZEMOYPUTDOC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|