C24H32N6O9 — CID 166530820
[(2R,3S,4R,5R)-5-[5-[(Z)-N'-(acetyloxymethoxycarbonyl)-N-(aminomethylidene)carbamimidoyl]-1H-pyrrol-2-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate (PubChem CID 166530820) has the molecular formula C24H32N6O9 and a molecular weight of 548.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-[(Z)-N'-(acetyloxymethoxycarbonyl)-N-(aminomethylidene)carbamimidoyl]-1H-pyrrol-2-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate.
| Compound Name | [(2R,3S,4R,5R)-5-[5-[(Z)-N'-(acetyloxymethoxycarbonyl)-N-(aminomethylidene)carbamimidoyl]-1H-pyrrol-2-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate |
|---|---|
| PubChem CID | 166530820 |
| Molecular Formula | C24H32N6O9 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-[(Z)-N'-(acetyloxymethoxycarbonyl)-N-(aminomethylidene)carbamimidoyl]-1H-pyrrol-2-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate |
| SMILES | CC(=O)OCOC(=O)/N=C(\N=C\N)c1ccc([C@]2(C#N)O[C@H](COC(=O)CC3(N)CCCCC3)[C@@H](O)[C@H]2O)[nH]1 |
| InChI | InChI=1S/C24H32N6O9/c1-14(31)37-13-38-22(35)30-21(28-12-26)15-5-6-17(29-15)24(11-25)20(34)19(33)16(39-24)10-36-18(32)9-23(27)7-3-2-4-8-23/h5-6,12,16,19-20,29,33-34H,2-4,7-10,13,27H2,1H3,(H2,26,28,30,35)/t16-,19-,20-,24+/m1/s1 |
| InChIKey | YORHNXBZUBVXME-YBNJHJSASA-N |
| XLogP | -0.16 |
| TPSA | 244.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|