C24H30N4O5 — CID 166530924
[5-[5-[N-(aminomethylidene)-N'-benzoylcarbamimidoyl]-1H-pyrrol-2-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate (PubChem CID 166530924) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is [5-[5-[N-(aminomethylidene)-N'-benzoylcarbamimidoyl]-1H-pyrrol-2-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate.
| Compound Name | [5-[5-[N-(aminomethylidene)-N'-benzoylcarbamimidoyl]-1H-pyrrol-2-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 166530924 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | [5-[5-[N-(aminomethylidene)-N'-benzoylcarbamimidoyl]-1H-pyrrol-2-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOCC1CCC(c2ccc(C(=N/C(=O)c3ccccc3)/N=C/N)[nH]2)O1 |
| InChI | InChI=1S/C24H30N4O5/c1-24(2,3)23(30)32-15-31-13-17-9-12-20(33-17)18-10-11-19(27-18)21(26-14-25)28-22(29)16-7-5-4-6-8-16/h4-8,10-11,14,17,20,27H,9,12-13,15H2,1-3H3,(H2,25,26,28,29) |
| InChIKey | IIJLMUNMSKCSPP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|