About 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol
2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol (PubChem CID 166531011) has the molecular formula C10H16O3
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol |
| PubChem CID | 166531011 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol |
| SMILES | OCC(CO)OCC1=CCCC=C1 |
| InChI | InChI=1S/C10H16O3/c11-6-10(7-12)13-8-9-4-2-1-3-5-9/h2,4-5,10-12H,1,3,6-8H2 |
| InChIKey | JHGOGMQNFZFNAR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol?
The IUPAC name of 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol (CID 166531011) is 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol.
What is the SMILES notation for 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol?
The canonical SMILES for 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol is OCC(CO)OCC1=CCCC=C1.
What is the InChIKey of 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol?
The InChIKey is JHGOGMQNFZFNAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c11-6-10(7-12)13-8-9-4-2-1-3-5-9/h2,4-5,10-12H,1,3,6-8H2.
What are the key properties of 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol?
2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol has a molecular weight of 184.24 g/mol, XLogP of 0.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexa-1,5-dien-1-ylmethoxy)propane-1,3-diol is sourced from PubChem (CID 166531011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).