C22H30FN5O5 — CID 166531550
(1Z)-1-[(aminomethylideneamino)-[5-[5-(hydroxymethyl)oxolan-2-yl]-1H-pyrrol-2-yl]methylidene]-3-[(4-fluorophenyl)methyl]urea;propane-2,2-diol (PubChem CID 166531550) has the molecular formula C22H30FN5O5 and a molecular weight of 463.51 g/mol. Its IUPAC name is (1Z)-1-[(aminomethylideneamino)-[5-[5-(hydroxymethyl)oxolan-2-yl]-1H-pyrrol-2-yl]methylidene]-3-[(4-fluorophenyl)methyl]urea;propane-2,2-diol.
| Compound Name | (1Z)-1-[(aminomethylideneamino)-[5-[5-(hydroxymethyl)oxolan-2-yl]-1H-pyrrol-2-yl]methylidene]-3-[(4-fluorophenyl)methyl]urea;propane-2,2-diol |
|---|---|
| PubChem CID | 166531550 |
| Molecular Formula | C22H30FN5O5 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | (1Z)-1-[(aminomethylideneamino)-[5-[5-(hydroxymethyl)oxolan-2-yl]-1H-pyrrol-2-yl]methylidene]-3-[(4-fluorophenyl)methyl]urea;propane-2,2-diol |
| SMILES | CC(C)(O)O.N/C=N/C(=N\C(=O)NCc1ccc(F)cc1)c1ccc(C2CCC(CO)O2)[nH]1 |
| InChI | InChI=1S/C19H22FN5O3.C3H8O2/c20-13-3-1-12(2-4-13)9-22-19(27)25-18(23-11-21)16-7-6-15(24-16)17-8-5-14(10-26)28-17;1-3(2,4)5/h1-4,6-7,11,14,17,24,26H,5,8-10H2,(H3,21,22,23,25,27);4-5H,1-2H3 |
| InChIKey | HHSAILGCYYBNCC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 165.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|