C20H17F5IN5O3 — CID 166532146
1-[1-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)-2,2,2-trifluoroethyl]-3-[2-[(3R)-3-iodomorpholin-4-yl]pyrimidin-5-yl]urea (PubChem CID 166532146) has the molecular formula C20H17F5IN5O3 and a molecular weight of 597.28 g/mol. Its IUPAC name is 1-[1-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)-2,2,2-trifluoroethyl]-3-[2-[(3R)-3-iodomorpholin-4-yl]pyrimidin-5-yl]urea.
| Compound Name | 1-[1-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)-2,2,2-trifluoroethyl]-3-[2-[(3R)-3-iodomorpholin-4-yl]pyrimidin-5-yl]urea |
|---|---|
| PubChem CID | 166532146 |
| Molecular Formula | C20H17F5IN5O3 |
| Molecular Weight | 597.28 g/mol |
| Exact Mass | 597.03 |
| IUPAC Name | 1-[1-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)-2,2,2-trifluoroethyl]-3-[2-[(3R)-3-iodomorpholin-4-yl]pyrimidin-5-yl]urea |
| SMILES | Cc1c(C(NC(=O)Nc2cnc(N3CCOC[C@H]3I)nc2)C(F)(F)F)oc2c(F)cc(F)cc12 |
| InChI | InChI=1S/C20H17F5IN5O3/c1-9-12-4-10(21)5-13(22)16(12)34-15(9)17(20(23,24)25)30-19(32)29-11-6-27-18(28-7-11)31-2-3-33-8-14(31)26/h4-7,14,17H,2-3,8H2,1H3,(H2,29,30,32)/t14-,17?/m0/s1 |
| InChIKey | LBPZKUBIDDWOHR-MBIQTGHCSA-N |
| XLogP | 4.83 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|