C22H22N6O3 — CID 16653260
4-amino-5-(4-nitrophenyl)-2-piperidin-1-yl-8,9-dihydro-7H-pyrimido[4,5-b]quinolin-6-one (PubChem CID 16653260) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 4-amino-5-(4-nitrophenyl)-2-piperidin-1-yl-8,9-dihydro-7H-pyrimido[4,5-b]quinolin-6-one.
| Compound Name | 4-amino-5-(4-nitrophenyl)-2-piperidin-1-yl-8,9-dihydro-7H-pyrimido[4,5-b]quinolin-6-one |
|---|---|
| PubChem CID | 16653260 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 4-amino-5-(4-nitrophenyl)-2-piperidin-1-yl-8,9-dihydro-7H-pyrimido[4,5-b]quinolin-6-one |
| SMILES | Nc1nc(N2CCCCC2)nc2nc3c(c(-c4ccc([N+](=O)[O-])cc4)c12)C(=O)CCC3 |
| InChI | InChI=1S/C22H22N6O3/c23-20-19-17(13-7-9-14(10-8-13)28(30)31)18-15(5-4-6-16(18)29)24-21(19)26-22(25-20)27-11-2-1-3-12-27/h7-10H,1-6,11-12H2,(H2,23,24,25,26) |
| InChIKey | SMLZHFZHAYRJOR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 128.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|