About [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane
[1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane (PubChem CID 166533365) has the molecular formula C12H23F2NO
and a molecular weight of 235.32 g/mol. Its IUPAC name is [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane.
Molecular Properties
| Compound Name | [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane |
| PubChem CID | 166533365 |
| Molecular Formula | C12H23F2NO |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane |
| SMILES | CCC.OCC1(CN2CCC(F)(F)C2)CC1 |
| InChI | InChI=1S/C9H15F2NO.C3H8/c10-9(11)3-4-12(6-9)5-8(7-13)1-2-8;1-3-2/h13H,1-7H2;3H2,1-2H3 |
| InChIKey | SHRUFXYKFSQVQA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane?
The IUPAC name of [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane (CID 166533365) is [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane.
What is the SMILES notation for [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane?
The canonical SMILES for [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane is CCC.OCC1(CN2CCC(F)(F)C2)CC1.
What is the InChIKey of [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane?
The InChIKey is SHRUFXYKFSQVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO.C3H8/c10-9(11)3-4-12(6-9)5-8(7-13)1-2-8;1-3-2/h13H,1-7H2;3H2,1-2H3.
What are the key properties of [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane?
[1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane has a molecular weight of 235.32 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopropyl]methanol;propane is sourced from PubChem (CID 166533365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).