C12H28N2O — CID 166533373
ethane;1-(3-methoxypropyl)-3-methyl-1,4-diazepane (PubChem CID 166533373) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is ethane;1-(3-methoxypropyl)-3-methyl-1,4-diazepane.
| Compound Name | ethane;1-(3-methoxypropyl)-3-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 166533373 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | ethane;1-(3-methoxypropyl)-3-methyl-1,4-diazepane |
| SMILES | CC.COCCCN1CCCNC(C)C1 |
| InChI | InChI=1S/C10H22N2O.C2H6/c1-10-9-12(6-3-5-11-10)7-4-8-13-2;1-2/h10-11H,3-9H2,1-2H3;1-2H3 |
| InChIKey | CKQZETCWYZVVFM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|