About 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one
4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one (PubChem CID 166533506) has the molecular formula C11H8Cl2FN3OS
and a molecular weight of 320.18 g/mol. Its IUPAC name is 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one |
| PubChem CID | 166533506 |
| Molecular Formula | C11H8Cl2FN3OS |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one |
| SMILES | CSc1nc(Cl)c2c(=O)n(C3CC3)c(Cl)c(F)c2n1 |
| InChI | InChI=1S/C11H8Cl2FN3OS/c1-19-11-15-7-5(8(12)16-11)10(18)17(4-2-3-4)9(13)6(7)14/h4H,2-3H2,1H3 |
| InChIKey | YRYKCRHHOFNOGH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The IUPAC name of 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one (CID 166533506) is 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one.
What is the SMILES notation for 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The canonical SMILES for 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one is CSc1nc(Cl)c2c(=O)n(C3CC3)c(Cl)c(F)c2n1.
What is the InChIKey of 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The InChIKey is YRYKCRHHOFNOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2FN3OS/c1-19-11-15-7-5(8(12)16-11)10(18)17(4-2-3-4)9(13)6(7)14/h4H,2-3H2,1H3.
What are the key properties of 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one has a molecular weight of 320.18 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dichloro-6-cyclopropyl-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one is sourced from PubChem (CID 166533506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).