C15H28N2O3 — CID 166533681
[(3R,8R)-8-(propan-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N,N-dimethylcarbamate (PubChem CID 166533681) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is [(3R,8R)-8-(propan-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N,N-dimethylcarbamate.
| Compound Name | [(3R,8R)-8-(propan-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 166533681 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | [(3R,8R)-8-(propan-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N,N-dimethylcarbamate |
| SMILES | CC(C)OC[C@]12CCCN1[C@@H](COC(=O)N(C)C)CC2 |
| InChI | InChI=1S/C15H28N2O3/c1-12(2)20-11-15-7-5-9-17(15)13(6-8-15)10-19-14(18)16(3)4/h12-13H,5-11H2,1-4H3/t13-,15-/m1/s1 |
| InChIKey | ZZSHMKFBSLHFGG-UKRRQHHQSA-N |
| XLogP | 2.11 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |