About ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine
ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine (PubChem CID 166534171) has the molecular formula C13H27F2NO
and a molecular weight of 251.36 g/mol. Its IUPAC name is ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine.
Molecular Properties
| Compound Name | ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine |
| PubChem CID | 166534171 |
| Molecular Formula | C13H27F2NO |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine |
| SMILES | CC.CCN(CC(C)(F)F)CC1(COC)CC1 |
| InChI | InChI=1S/C11H21F2NO.C2H6/c1-4-14(7-10(2,12)13)8-11(5-6-11)9-15-3;1-2/h4-9H2,1-3H3;1-2H3 |
| InChIKey | QFKQBBVCWCILGV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine?
The IUPAC name of ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine (CID 166534171) is ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine.
What is the SMILES notation for ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine?
The canonical SMILES for ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine is CC.CCN(CC(C)(F)F)CC1(COC)CC1.
What is the InChIKey of ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine?
The InChIKey is QFKQBBVCWCILGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2NO.C2H6/c1-4-14(7-10(2,12)13)8-11(5-6-11)9-15-3;1-2/h4-9H2,1-3H3;1-2H3.
What are the key properties of ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine?
ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine has a molecular weight of 251.36 g/mol, XLogP of 3.42, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-2,2-difluoro-N-[[1-(methoxymethyl)cyclopropyl]methyl]propan-1-amine is sourced from PubChem (CID 166534171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).