C13H10ClF3N2O3S — CID 166534320
8-chloro-12-(methoxymethyl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione (PubChem CID 166534320) has the molecular formula C13H10ClF3N2O3S and a molecular weight of 366.75 g/mol. Its IUPAC name is 8-chloro-12-(methoxymethyl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione.
| Compound Name | 8-chloro-12-(methoxymethyl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione |
|---|---|
| PubChem CID | 166534320 |
| Molecular Formula | C13H10ClF3N2O3S |
| Molecular Weight | 366.75 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 8-chloro-12-(methoxymethyl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione |
| SMILES | COCC1CSc2c(Cl)c(C(F)(F)F)cc3c(=O)[nH]c(=O)n1c23 |
| InChI | InChI=1S/C13H10ClF3N2O3S/c1-22-3-5-4-23-10-8(14)7(13(15,16)17)2-6-9(10)19(5)12(21)18-11(6)20/h2,5H,3-4H2,1H3,(H,18,20,21) |
| InChIKey | BJMDTUBKGJWJBI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.75 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |