C20H20Cl2N2O2 — CID 166534851
1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 166534851) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is 1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166534851 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccc(N3CC(c4c(Cl)cccc4Cl)C3)cc2)C1 |
| InChI | InChI=1S/C20H20Cl2N2O2/c21-17-2-1-3-18(22)19(17)14-11-24(12-14)16-6-4-13(5-7-16)8-23-9-15(10-23)20(25)26/h1-7,14-15H,8-12H2,(H,25,26) |
| InChIKey | TWXNKLDVUOPHBM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|