C16H28 — CID 166534855
ethane;1,5,7-trimethyl-2,3-dihydro-1H-indene (PubChem CID 166534855) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is ethane;1,5,7-trimethyl-2,3-dihydro-1H-indene.
| Compound Name | ethane;1,5,7-trimethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 166534855 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | ethane;1,5,7-trimethyl-2,3-dihydro-1H-indene |
| SMILES | CC.CC.Cc1cc(C)c2c(c1)CCC2C |
| InChI | InChI=1S/C12H16.2C2H6/c1-8-6-10(3)12-9(2)4-5-11(12)7-8;2*1-2/h6-7,9H,4-5H2,1-3H3;2*1-2H3 |
| InChIKey | VZMMMKASELGVJF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |