C18H24BN3O2 — CID 166534928
methyl 1-[[6-(1-cyanoboretan-3-yl)-5-methyl-3-pyridinyl]methyl]piperidine-4-carboxylate (PubChem CID 166534928) has the molecular formula C18H24BN3O2 and a molecular weight of 325.22 g/mol. Its IUPAC name is methyl 1-[[6-(1-cyanoboretan-3-yl)-5-methyl-3-pyridinyl]methyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[6-(1-cyanoboretan-3-yl)-5-methyl-3-pyridinyl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 166534928 |
| Molecular Formula | C18H24BN3O2 |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | methyl 1-[[6-(1-cyanoboretan-3-yl)-5-methyl-3-pyridinyl]methyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(Cc2cnc(C3CB(C#N)C3)c(C)c2)CC1 |
| InChI | InChI=1S/C18H24BN3O2/c1-13-7-14(10-21-17(13)16-8-19(9-16)12-20)11-22-5-3-15(4-6-22)18(23)24-2/h7,10,15-16H,3-6,8-9,11H2,1-2H3 |
| InChIKey | AVZMVCDQCUZFGJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|