About 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol
1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol (PubChem CID 166536269) has the molecular formula C13H23BrN2S
and a molecular weight of 319.31 g/mol. Its IUPAC name is 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol.
Molecular Properties
| Compound Name | 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol |
| PubChem CID | 166536269 |
| Molecular Formula | C13H23BrN2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol |
| SMILES | CC.CC(C)(C)S.[H]/N=C(\C)c1ccc(Br)nc1 |
| InChI | InChI=1S/C7H7BrN2.C4H10S.C2H6/c1-5(9)6-2-3-7(8)10-4-6;1-4(2,3)5;1-2/h2-4,9H,1H3;5H,1-3H3;1-2H3/b9-5+;; |
| InChIKey | DGMJVWOCWGLYST-KJDUPKRESA-N |
| XLogP | 4.97 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol?
The IUPAC name of 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol (CID 166536269) is 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol.
What is the SMILES notation for 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol?
The canonical SMILES for 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol is CC.CC(C)(C)S.[H]/N=C(\C)c1ccc(Br)nc1.
What is the InChIKey of 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol?
The InChIKey is DGMJVWOCWGLYST-KJDUPKRESA-N. The full InChI is InChI=1S/C7H7BrN2.C4H10S.C2H6/c1-5(9)6-2-3-7(8)10-4-6;1-4(2,3)5;1-2/h2-4,9H,1H3;5H,1-3H3;1-2H3/b9-5+;;.
What are the key properties of 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol?
1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol has a molecular weight of 319.31 g/mol, XLogP of 4.97, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-3-pyridinyl)ethanimine;ethane;2-methylpropane-2-thiol is sourced from PubChem (CID 166536269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).