C14H24FN3O2 — CID 166537666
(3S,3aS,6aR)-2-[(2R)-3-fluoro-3-methyl-2-(methylamino)butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 166537666) has the molecular formula C14H24FN3O2 and a molecular weight of 285.36 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-[(2R)-3-fluoro-3-methyl-2-(methylamino)butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS,6aR)-2-[(2R)-3-fluoro-3-methyl-2-(methylamino)butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 166537666 |
| Molecular Formula | C14H24FN3O2 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (3S,3aS,6aR)-2-[(2R)-3-fluoro-3-methyl-2-(methylamino)butanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CN[C@H](C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(N)=O)C(C)(C)F |
| InChI | InChI=1S/C14H24FN3O2/c1-14(2,15)11(17-3)13(20)18-7-8-5-4-6-9(8)10(18)12(16)19/h8-11,17H,4-7H2,1-3H3,(H2,16,19)/t8-,9-,10-,11+/m0/s1 |
| InChIKey | QLISHNKUSNWYRB-XWLWVQCSSA-N |
| XLogP | 0.43 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |